C14H20ClN3O3 — CID 108988465
N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpiperazine-1-carboxamide (PubChem CID 108988465) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpiperazine-1-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108988465 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpiperazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN(C)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c1-17-4-6-18(7-5-17)14(19)16-11-9-12(20-2)10(15)8-13(11)21-3/h8-9H,4-7H2,1-3H3,(H,16,19) |
| InChIKey | OETVMRUULZCIST-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |