C19H29N3O2S — CID 4996156
ethyl 2-[4-[(4-tert-butylphenyl)carbamothioyl]piperazin-1-yl]acetate (PubChem CID 4996156) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is ethyl 2-[4-[(4-tert-butylphenyl)carbamothioyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(4-tert-butylphenyl)carbamothioyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 4996156 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | ethyl 2-[4-[(4-tert-butylphenyl)carbamothioyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(C(=S)Nc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-5-24-17(23)14-21-10-12-22(13-11-21)18(25)20-16-8-6-15(7-9-16)19(2,3)4/h6-9H,5,10-14H2,1-4H3,(H,20,25) |
| InChIKey | CPJGDHRRUKCWIJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|