C22H28FN3S — CID 4982600
N-(4-tert-butylphenyl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 4982600) has the molecular formula C22H28FN3S and a molecular weight of 385.55 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-tert-butylphenyl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4982600 |
| Molecular Formula | C22H28FN3S |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | CC(C)(C)c1ccc(NC(=S)N2CCN(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H28FN3S/c1-22(2,3)18-6-10-20(11-7-18)24-21(27)26-14-12-25(13-15-26)16-17-4-8-19(23)9-5-17/h4-11H,12-16H2,1-3H3,(H,24,27) |
| InChIKey | ROCWTKKFKAWTJW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|