C15H22N2O3 — CID 82149367
2-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)ethanol (PubChem CID 82149367) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)ethanol.
| Compound Name | 2-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 82149367 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)ethanol |
| SMILES | COc1cc2nc(C(C)(C)C)n(CCO)c2cc1OC |
| InChI | InChI=1S/C15H22N2O3/c1-15(2,3)14-16-10-8-12(19-4)13(20-5)9-11(10)17(14)6-7-18/h8-9,18H,6-7H2,1-5H3 |
| InChIKey | DYCXHBLDXSATOO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |