C16H24N2O3 — CID 82149576
3-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol (PubChem CID 82149576) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol.
| Compound Name | 3-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 82149576 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-(2-tert-butyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol |
| SMILES | COc1cc2nc(C(C)(C)C)n(CCCO)c2cc1OC |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)15-17-11-9-13(20-4)14(21-5)10-12(11)18(15)7-6-8-19/h9-10,19H,6-8H2,1-5H3 |
| InChIKey | SAEHSHOAUVRTEZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |