C19H20N2O3 — CID 82149384
2-[5,6-dimethoxy-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]ethanol (PubChem CID 82149384) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[5,6-dimethoxy-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]ethanol.
| Compound Name | 2-[5,6-dimethoxy-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 82149384 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[5,6-dimethoxy-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]ethanol |
| SMILES | COc1cc2nc(/C=C/c3ccccc3)n(CCO)c2cc1OC |
| InChI | InChI=1S/C19H20N2O3/c1-23-17-12-15-16(13-18(17)24-2)21(10-11-22)19(20-15)9-8-14-6-4-3-5-7-14/h3-9,12-13,22H,10-11H2,1-2H3/b9-8+ |
| InChIKey | VGILIIHMBRPPNT-CMDGGOBGSA-N |
| XLogP | 3.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |