C19H19N3O — CID 11833693
2-[(E)-2-phenylethenyl]-1-propylbenzimidazole-5-carboxamide (PubChem CID 11833693) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-1-propylbenzimidazole-5-carboxamide.
| Compound Name | 2-[(E)-2-phenylethenyl]-1-propylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11833693 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-1-propylbenzimidazole-5-carboxamide |
| SMILES | CCCn1c(/C=C/c2ccccc2)nc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C19H19N3O/c1-2-12-22-17-10-9-15(19(20)23)13-16(17)21-18(22)11-8-14-6-4-3-5-7-14/h3-11,13H,2,12H2,1H3,(H2,20,23)/b11-8+ |
| InChIKey | YMXMXQFFFQZKBK-DHZHZOJOSA-N |
| XLogP | 3.72 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |