C20H23N3 — CID 78505875
N,N-dimethyl-4-[2-(1-propylbenzimidazol-2-yl)ethenyl]aniline (PubChem CID 78505875) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(1-propylbenzimidazol-2-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(1-propylbenzimidazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 78505875 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N,N-dimethyl-4-[2-(1-propylbenzimidazol-2-yl)ethenyl]aniline |
| SMILES | CCCn1c(C=Cc2ccc(N(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H23N3/c1-4-15-23-19-8-6-5-7-18(19)21-20(23)14-11-16-9-12-17(13-10-16)22(2)3/h5-14H,4,15H2,1-3H3 |
| InChIKey | VEZIJGVVMPRCDZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|