C21H23N3 — CID 5135416
N,N-dimethyl-4-[2-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]ethenyl]aniline (PubChem CID 5135416) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 5135416 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N,N-dimethyl-4-[2-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]ethenyl]aniline |
| SMILES | C=C(C)Cn1c(C=Cc2ccc(N(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C21H23N3/c1-16(2)15-24-20-8-6-5-7-19(20)22-21(24)14-11-17-9-12-18(13-10-17)23(3)4/h5-14H,1,15H2,2-4H3 |
| InChIKey | IHQTUDDYLOKZOA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|