C16H16N4O2 — CID 164903398
2-amino-1-[(2S)-2-hydroxy-2-phenylethyl]benzimidazole-5-carboxamide (PubChem CID 164903398) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-1-[(2S)-2-hydroxy-2-phenylethyl]benzimidazole-5-carboxamide.
| Compound Name | 2-amino-1-[(2S)-2-hydroxy-2-phenylethyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 164903398 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-amino-1-[(2S)-2-hydroxy-2-phenylethyl]benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(N)n2C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H16N4O2/c17-15(22)11-6-7-13-12(8-11)19-16(18)20(13)9-14(21)10-4-2-1-3-5-10/h1-8,14,21H,9H2,(H2,17,22)(H2,18,19)/t14-/m1/s1 |
| InChIKey | YJVOEKRLTVZFNA-CQSZACIVSA-N |
| XLogP | 1.45 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |