C18H26N2O3 — CID 94756206
3-(2-cyclohexyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol (PubChem CID 94756206) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-(2-cyclohexyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol.
| Compound Name | 3-(2-cyclohexyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 94756206 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 3-(2-cyclohexyl-5,6-dimethoxybenzimidazol-1-yl)propan-1-ol |
| SMILES | COc1cc2nc(C3CCCCC3)n(CCCO)c2cc1OC |
| InChI | InChI=1S/C18H26N2O3/c1-22-16-11-14-15(12-17(16)23-2)20(9-6-10-21)18(19-14)13-7-4-3-5-8-13/h11-13,21H,3-10H2,1-2H3 |
| InChIKey | AWGYSZFCYJIHCY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |