C19H25N3O3 — CID 87516617
N-[2-cyclohexyl-1-(3-hydroxypropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 87516617) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-cyclohexyl-1-(3-hydroxypropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | N-[2-cyclohexyl-1-(3-hydroxypropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87516617 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[2-cyclohexyl-1-(3-hydroxypropyl)benzimidazol-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | C=CC(=O)N(O)c1ccc2c(c1)nc(C1CCCCC1)n2CCCO |
| InChI | InChI=1S/C19H25N3O3/c1-2-18(24)22(25)15-9-10-17-16(13-15)20-19(21(17)11-6-12-23)14-7-4-3-5-8-14/h2,9-10,13-14,23,25H,1,3-8,11-12H2 |
| InChIKey | PYMFTGWZTPXDMT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|