C15H22N2O — CID 82149314
2-(2-tert-butyl-5,6-dimethylbenzimidazol-1-yl)ethanol (PubChem CID 82149314) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(2-tert-butyl-5,6-dimethylbenzimidazol-1-yl)ethanol.
| Compound Name | 2-(2-tert-butyl-5,6-dimethylbenzimidazol-1-yl)ethanol |
|---|---|
| PubChem CID | 82149314 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-(2-tert-butyl-5,6-dimethylbenzimidazol-1-yl)ethanol |
| SMILES | Cc1cc2nc(C(C)(C)C)n(CCO)c2cc1C |
| InChI | InChI=1S/C15H22N2O/c1-10-8-12-13(9-11(10)2)17(6-7-18)14(16-12)15(3,4)5/h8-9,18H,6-7H2,1-5H3 |
| InChIKey | MOLJHDMZZWYEBJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |