C13H17ClN2O3 — CID 83007863
2-(chloromethyl)-5,6-dimethoxy-1-(2-methoxyethyl)benzimidazole (PubChem CID 83007863) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-dimethoxy-1-(2-methoxyethyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-5,6-dimethoxy-1-(2-methoxyethyl)benzimidazole |
|---|---|
| PubChem CID | 83007863 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(chloromethyl)-5,6-dimethoxy-1-(2-methoxyethyl)benzimidazole |
| SMILES | COCCn1c(CCl)nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C13H17ClN2O3/c1-17-5-4-16-10-7-12(19-3)11(18-2)6-9(10)15-13(16)8-14/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | XOKUWCAPHSWFDR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|