C14H19ClN2O3 — CID 83008681
2-(chloromethyl)-1-(2-ethoxyethyl)-5,6-dimethoxybenzimidazole (PubChem CID 83008681) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2-ethoxyethyl)-5,6-dimethoxybenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(2-ethoxyethyl)-5,6-dimethoxybenzimidazole |
|---|---|
| PubChem CID | 83008681 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(chloromethyl)-1-(2-ethoxyethyl)-5,6-dimethoxybenzimidazole |
| SMILES | CCOCCn1c(CCl)nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H19ClN2O3/c1-4-20-6-5-17-11-8-13(19-3)12(18-2)7-10(11)16-14(17)9-15/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | LLTPTUYEVLJITR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|