C13H14ClFN2O3 — CID 63599125
ethyl 2-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]acetate (PubChem CID 63599125) has the molecular formula C13H14ClFN2O3 and a molecular weight of 300.72 g/mol. Its IUPAC name is ethyl 2-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 63599125 |
| Molecular Formula | C13H14ClFN2O3 |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | ethyl 2-[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(CCl)nc2cc(F)c(OC)cc21 |
| InChI | InChI=1S/C13H14ClFN2O3/c1-3-20-13(18)7-17-10-5-11(19-2)8(15)4-9(10)16-12(17)6-14/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | VGWZNLXTPFYFKN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|