C13H11ClFN3O2S — CID 106382671
4-[[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382671) has the molecular formula C13H11ClFN3O2S and a molecular weight of 327.77 g/mol. Its IUPAC name is 4-[[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382671 |
| Molecular Formula | C13H11ClFN3O2S |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-[[2-(chloromethyl)-5-fluoro-6-methoxybenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | COc1cc2c(cc1F)nc(CCl)n2Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C13H11ClFN3O2S/c1-20-11-3-10-9(2-8(11)15)17-12(4-14)18(10)5-7-6-21-13(19)16-7/h2-3,6H,4-5H2,1H3,(H,16,19) |
| InChIKey | GCPZESUFUVOQRD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|