C14H11ClN4OS — CID 106382656
2-(2-chloroethyl)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzimidazole-5-carbonitrile (PubChem CID 106382656) has the molecular formula C14H11ClN4OS and a molecular weight of 318.79 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzimidazole-5-carbonitrile.
| Compound Name | 2-(2-chloroethyl)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 106382656 |
| Molecular Formula | C14H11ClN4OS |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 2-(2-chloroethyl)-3-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(CCCl)n(Cc3csc(=O)[nH]3)c2c1 |
| InChI | InChI=1S/C14H11ClN4OS/c15-4-3-13-18-11-2-1-9(6-16)5-12(11)19(13)7-10-8-21-14(20)17-10/h1-2,5,8H,3-4,7H2,(H,17,20) |
| InChIKey | UCUQNLUJPOZZPK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|