C14H14ClN3OS — CID 106382638
4-[[2-(2-chloroethyl)-4-methylbenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382638) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 4-[[2-(2-chloroethyl)-4-methylbenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(2-chloroethyl)-4-methylbenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382638 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-[[2-(2-chloroethyl)-4-methylbenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Cc1cccc2c1nc(CCCl)n2Cc1csc(=O)[nH]1 |
| InChI | InChI=1S/C14H14ClN3OS/c1-9-3-2-4-11-13(9)17-12(5-6-15)18(11)7-10-8-20-14(19)16-10/h2-4,8H,5-7H2,1H3,(H,16,19) |
| InChIKey | LVEWZKMKNSGCNE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|