C13H10ClF2N3OS — CID 106382624
4-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382624) has the molecular formula C13H10ClF2N3OS and a molecular weight of 329.76 g/mol. Its IUPAC name is 4-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382624 |
| Molecular Formula | C13H10ClF2N3OS |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 4-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(Cn2c(CCCl)nc3ccc(F)c(F)c32)cs1 |
| InChI | InChI=1S/C13H10ClF2N3OS/c14-4-3-10-18-9-2-1-8(15)11(16)12(9)19(10)5-7-6-21-13(20)17-7/h1-2,6H,3-5H2,(H,17,20) |
| InChIKey | LKADOKOBORDZRZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|