C13H10ClF2N3O — CID 106420558
5-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 106420558) has the molecular formula C13H10ClF2N3O and a molecular weight of 297.69 g/mol. Its IUPAC name is 5-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 106420558 |
| Molecular Formula | C13H10ClF2N3O |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 5-[[2-(2-chloroethyl)-6,7-difluorobenzimidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | Fc1ccc2nc(CCCl)n(Cc3ccno3)c2c1F |
| InChI | InChI=1S/C13H10ClF2N3O/c14-5-3-11-18-10-2-1-9(15)12(16)13(10)19(11)7-8-4-6-17-20-8/h1-2,4,6H,3,5,7H2 |
| InChIKey | ZQOUYSJZOJVTOA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|