C14H13ClF2N4 — CID 82872686
2-(2-chloroethyl)-6,7-difluoro-1-[(1-methylpyrazol-3-yl)methyl]benzimidazole (PubChem CID 82872686) has the molecular formula C14H13ClF2N4 and a molecular weight of 310.74 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6,7-difluoro-1-[(1-methylpyrazol-3-yl)methyl]benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6,7-difluoro-1-[(1-methylpyrazol-3-yl)methyl]benzimidazole |
|---|---|
| PubChem CID | 82872686 |
| Molecular Formula | C14H13ClF2N4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(2-chloroethyl)-6,7-difluoro-1-[(1-methylpyrazol-3-yl)methyl]benzimidazole |
| SMILES | Cn1ccc(Cn2c(CCCl)nc3ccc(F)c(F)c32)n1 |
| InChI | InChI=1S/C14H13ClF2N4/c1-20-7-5-9(19-20)8-21-12(4-6-15)18-11-3-2-10(16)13(17)14(11)21/h2-3,5,7H,4,6,8H2,1H3 |
| InChIKey | SZHJPORQVDUGDV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|