C15H19ClF2N2O — CID 62532229
1-(2-butoxyethyl)-2-(2-chloroethyl)-6,7-difluorobenzimidazole (PubChem CID 62532229) has the molecular formula C15H19ClF2N2O and a molecular weight of 316.78 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-2-(2-chloroethyl)-6,7-difluorobenzimidazole.
| Compound Name | 1-(2-butoxyethyl)-2-(2-chloroethyl)-6,7-difluorobenzimidazole |
|---|---|
| PubChem CID | 62532229 |
| Molecular Formula | C15H19ClF2N2O |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-(2-butoxyethyl)-2-(2-chloroethyl)-6,7-difluorobenzimidazole |
| SMILES | CCCCOCCn1c(CCCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C15H19ClF2N2O/c1-2-3-9-21-10-8-20-13(6-7-16)19-12-5-4-11(17)14(18)15(12)20/h4-5H,2-3,6-10H2,1H3 |
| InChIKey | YQILCTLUPNJCEH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|