C14H17ClF2N2O — CID 62532053
2-(2-chloroethyl)-6,7-difluoro-1-(4-methoxybutyl)benzimidazole (PubChem CID 62532053) has the molecular formula C14H17ClF2N2O and a molecular weight of 302.75 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6,7-difluoro-1-(4-methoxybutyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6,7-difluoro-1-(4-methoxybutyl)benzimidazole |
|---|---|
| PubChem CID | 62532053 |
| Molecular Formula | C14H17ClF2N2O |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-(2-chloroethyl)-6,7-difluoro-1-(4-methoxybutyl)benzimidazole |
| SMILES | COCCCCn1c(CCCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C14H17ClF2N2O/c1-20-9-3-2-8-19-12(6-7-15)18-11-5-4-10(16)13(17)14(11)19/h4-5H,2-3,6-9H2,1H3 |
| InChIKey | PJCLFSJRWKQJAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|