C14H17ClF2N2 — CID 63004461
2-(chloromethyl)-6,7-difluoro-1-(4-methylpentyl)benzimidazole (PubChem CID 63004461) has the molecular formula C14H17ClF2N2 and a molecular weight of 286.75 g/mol. Its IUPAC name is 2-(chloromethyl)-6,7-difluoro-1-(4-methylpentyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6,7-difluoro-1-(4-methylpentyl)benzimidazole |
|---|---|
| PubChem CID | 63004461 |
| Molecular Formula | C14H17ClF2N2 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(chloromethyl)-6,7-difluoro-1-(4-methylpentyl)benzimidazole |
| SMILES | CC(C)CCCn1c(CCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C14H17ClF2N2/c1-9(2)4-3-7-19-12(8-15)18-11-6-5-10(16)13(17)14(11)19/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | BELZKPCSMLAPQY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|