C14H16ClF2N3O — CID 62533395
4-[2-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]ethyl]morpholine (PubChem CID 62533395) has the molecular formula C14H16ClF2N3O and a molecular weight of 315.75 g/mol. Its IUPAC name is 4-[2-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 62533395 |
| Molecular Formula | C14H16ClF2N3O |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[2-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]ethyl]morpholine |
| SMILES | Fc1ccc2nc(CCl)n(CCN3CCOCC3)c2c1F |
| InChI | InChI=1S/C14H16ClF2N3O/c15-9-12-18-11-2-1-10(16)13(17)14(11)20(12)4-3-19-5-7-21-8-6-19/h1-2H,3-9H2 |
| InChIKey | BUTIYIQMFLEEHS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|