C11H7ClF6N2 — CID 106295132
2-(chloromethyl)-6,7-difluoro-1-(2,2,3,3-tetrafluoropropyl)benzimidazole (PubChem CID 106295132) has the molecular formula C11H7ClF6N2 and a molecular weight of 316.63 g/mol. Its IUPAC name is 2-(chloromethyl)-6,7-difluoro-1-(2,2,3,3-tetrafluoropropyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6,7-difluoro-1-(2,2,3,3-tetrafluoropropyl)benzimidazole |
|---|---|
| PubChem CID | 106295132 |
| Molecular Formula | C11H7ClF6N2 |
| Molecular Weight | 316.63 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-(chloromethyl)-6,7-difluoro-1-(2,2,3,3-tetrafluoropropyl)benzimidazole |
| SMILES | Fc1ccc2nc(CCl)n(CC(F)(F)C(F)F)c2c1F |
| InChI | InChI=1S/C11H7ClF6N2/c12-3-7-19-6-2-1-5(13)8(14)9(6)20(7)4-11(17,18)10(15)16/h1-2,10H,3-4H2 |
| InChIKey | GSZKDADLXIWGBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|