C15H20ClF2N3 — CID 62533385
3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine (PubChem CID 62533385) has the molecular formula C15H20ClF2N3 and a molecular weight of 315.80 g/mol. Its IUPAC name is 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine.
| Compound Name | 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine |
|---|---|
| PubChem CID | 62533385 |
| Molecular Formula | C15H20ClF2N3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-[2-(chloromethyl)-6,7-difluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine |
| SMILES | CN(C)CC(C)(C)Cn1c(CCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C15H20ClF2N3/c1-15(2,8-20(3)4)9-21-12(7-16)19-11-6-5-10(17)13(18)14(11)21/h5-6H,7-9H2,1-4H3 |
| InChIKey | LCIOLWAIDJPKCT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|