C16H21ClF2N2 — CID 115569242
2-(chloromethyl)-6,7-difluoro-1-octylbenzimidazole (PubChem CID 115569242) has the molecular formula C16H21ClF2N2 and a molecular weight of 314.81 g/mol. Its IUPAC name is 2-(chloromethyl)-6,7-difluoro-1-octylbenzimidazole.
| Compound Name | 2-(chloromethyl)-6,7-difluoro-1-octylbenzimidazole |
|---|---|
| PubChem CID | 115569242 |
| Molecular Formula | C16H21ClF2N2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(chloromethyl)-6,7-difluoro-1-octylbenzimidazole |
| SMILES | CCCCCCCCn1c(CCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C16H21ClF2N2/c1-2-3-4-5-6-7-10-21-14(11-17)20-13-9-8-12(18)15(19)16(13)21/h8-9H,2-7,10-11H2,1H3 |
| InChIKey | YRJPQISDNNFSFP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|