C15H18ClF2N3 — CID 62531896
2-(chloromethyl)-6,7-difluoro-1-(2-piperidin-1-ylethyl)benzimidazole (PubChem CID 62531896) has the molecular formula C15H18ClF2N3 and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-(chloromethyl)-6,7-difluoro-1-(2-piperidin-1-ylethyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-6,7-difluoro-1-(2-piperidin-1-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 62531896 |
| Molecular Formula | C15H18ClF2N3 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(chloromethyl)-6,7-difluoro-1-(2-piperidin-1-ylethyl)benzimidazole |
| SMILES | Fc1ccc2nc(CCl)n(CCN3CCCCC3)c2c1F |
| InChI | InChI=1S/C15H18ClF2N3/c16-10-13-19-12-5-4-11(17)14(18)15(12)21(13)9-8-20-6-2-1-3-7-20/h4-5H,1-3,6-10H2 |
| InChIKey | KRVIUWDTSJVQSJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|