C12H13ClF2N2O2S — CID 62533733
2-(2-chloroethyl)-6,7-difluoro-1-(2-methylsulfonylethyl)benzimidazole (PubChem CID 62533733) has the molecular formula C12H13ClF2N2O2S and a molecular weight of 322.76 g/mol. Its IUPAC name is 2-(2-chloroethyl)-6,7-difluoro-1-(2-methylsulfonylethyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-6,7-difluoro-1-(2-methylsulfonylethyl)benzimidazole |
|---|---|
| PubChem CID | 62533733 |
| Molecular Formula | C12H13ClF2N2O2S |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-(2-chloroethyl)-6,7-difluoro-1-(2-methylsulfonylethyl)benzimidazole |
| SMILES | CS(=O)(=O)CCn1c(CCCl)nc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C12H13ClF2N2O2S/c1-20(18,19)7-6-17-10(4-5-13)16-9-3-2-8(14)11(15)12(9)17/h2-3H,4-7H2,1H3 |
| InChIKey | WBWDZIXEEQWJTH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|