C11H9ClN4OS — CID 106382615
4-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382615) has the molecular formula C11H9ClN4OS and a molecular weight of 280.74 g/mol. Its IUPAC name is 4-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382615 |
| Molecular Formula | C11H9ClN4OS |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(Cn2c(CCl)nc3cccnc32)cs1 |
| InChI | InChI=1S/C11H9ClN4OS/c12-4-9-15-8-2-1-3-13-10(8)16(9)5-7-6-18-11(17)14-7/h1-3,6H,4-5H2,(H,14,17) |
| InChIKey | CLJLWTUIJGPESG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|