C16H14ClN5 — CID 142896639
2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,7-dihydrocyclohepta[d]imidazole (PubChem CID 142896639) has the molecular formula C16H14ClN5 and a molecular weight of 311.78 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,7-dihydrocyclohepta[d]imidazole.
| Compound Name | 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,7-dihydrocyclohepta[d]imidazole |
|---|---|
| PubChem CID | 142896639 |
| Molecular Formula | C16H14ClN5 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,7-dihydrocyclohepta[d]imidazole |
| SMILES | ClCc1nc2cccnc2n1Cc1nc2c([nH]1)=CC=CCC=2 |
| InChI | InChI=1S/C16H14ClN5/c17-9-15-21-13-7-4-8-18-16(13)22(15)10-14-19-11-5-2-1-3-6-12(11)20-14/h1-2,4-8H,3,9-10H2,(H,19,20) |
| InChIKey | KZHVFSSLGZCBDB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|