C12H12ClN5O — CID 114186561
3-[2-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 114186561) has the molecular formula C12H12ClN5O and a molecular weight of 277.72 g/mol. Its IUPAC name is 3-[2-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[2-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 114186561 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[2-[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]ethyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(CCn2c(CCl)nc3cccnc32)no1 |
| InChI | InChI=1S/C12H12ClN5O/c1-8-15-10(17-19-8)4-6-18-11(7-13)16-9-3-2-5-14-12(9)18/h2-3,5H,4,6-7H2,1H3 |
| InChIKey | APZHONZXCILUEI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|