C14H15ClN4O — CID 79294186
4-[[2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 79294186) has the molecular formula C14H15ClN4O and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-[[2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 79294186 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-[[2-(2-chloroethyl)imidazo[4,5-b]pyridin-3-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1Cn1c(CCCl)nc2cccnc21 |
| InChI | InChI=1S/C14H15ClN4O/c1-9-11(10(2)20-18-9)8-19-13(5-6-15)17-12-4-3-7-16-14(12)19/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | TYEWAPWBXLXIGK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|