C11H11ClF3N3S — CID 106431903
2-(2-chloroethyl)-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine (PubChem CID 106431903) has the molecular formula C11H11ClF3N3S and a molecular weight of 309.74 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 106431903 |
| Molecular Formula | C11H11ClF3N3S |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2-(2-chloroethyl)-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)SCCn1c(CCCl)nc2cccnc21 |
| InChI | InChI=1S/C11H11ClF3N3S/c12-4-3-9-17-8-2-1-5-16-10(8)18(9)6-7-19-11(13,14)15/h1-2,5H,3-4,6-7H2 |
| InChIKey | CWRNLBLYSACMMF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|