C12H13ClF3N3OS — CID 106432045
2-(2-chloroethyl)-5-methoxy-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine (PubChem CID 106432045) has the molecular formula C12H13ClF3N3OS and a molecular weight of 339.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-methoxy-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-5-methoxy-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 106432045 |
| Molecular Formula | C12H13ClF3N3OS |
| Molecular Weight | 339.77 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-(2-chloroethyl)-5-methoxy-3-[2-(trifluoromethylsulfanyl)ethyl]imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2nc(CCCl)n(CCSC(F)(F)F)c2n1 |
| InChI | InChI=1S/C12H13ClF3N3OS/c1-20-10-3-2-8-11(18-10)19(9(17-8)4-5-13)6-7-21-12(14,15)16/h2-3H,4-7H2,1H3 |
| InChIKey | SNEIENRYBZEGQU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.77 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|