C14H18ClN3O — CID 113286951
2-(2-chloroethyl)-3-(2-cyclopropylethyl)-5-methoxyimidazo[4,5-b]pyridine (PubChem CID 113286951) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-(2-cyclopropylethyl)-5-methoxyimidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3-(2-cyclopropylethyl)-5-methoxyimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 113286951 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(2-chloroethyl)-3-(2-cyclopropylethyl)-5-methoxyimidazo[4,5-b]pyridine |
| SMILES | COc1ccc2nc(CCCl)n(CCC3CC3)c2n1 |
| InChI | InChI=1S/C14H18ClN3O/c1-19-13-5-4-11-14(17-13)18(9-7-10-2-3-10)12(16-11)6-8-15/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | BIKCQCCMHGZOST-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|