C12H12ClF4N3O — CID 106295014
2-(2-chloroethyl)-5-methoxy-3-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-b]pyridine (PubChem CID 106295014) has the molecular formula C12H12ClF4N3O and a molecular weight of 325.69 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-methoxy-3-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-5-methoxy-3-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 106295014 |
| Molecular Formula | C12H12ClF4N3O |
| Molecular Weight | 325.69 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(2-chloroethyl)-5-methoxy-3-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2nc(CCCl)n(CC(F)(F)C(F)F)c2n1 |
| InChI | InChI=1S/C12H12ClF4N3O/c1-21-9-3-2-7-10(19-9)20(8(18-7)4-5-13)6-12(16,17)11(14)15/h2-3,11H,4-6H2,1H3 |
| InChIKey | RHSWFYFXZVHQPJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|