C16H24ClN3O — CID 115323122
2-(2-chloroethyl)-3-(3-ethylpentan-3-yl)-5-methoxyimidazo[4,5-b]pyridine (PubChem CID 115323122) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(2-chloroethyl)-3-(3-ethylpentan-3-yl)-5-methoxyimidazo[4,5-b]pyridine.
| Compound Name | 2-(2-chloroethyl)-3-(3-ethylpentan-3-yl)-5-methoxyimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 115323122 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(2-chloroethyl)-3-(3-ethylpentan-3-yl)-5-methoxyimidazo[4,5-b]pyridine |
| SMILES | CCC(CC)(CC)n1c(CCCl)nc2ccc(OC)nc21 |
| InChI | InChI=1S/C16H24ClN3O/c1-5-16(6-2,7-3)20-13(10-11-17)18-12-8-9-14(21-4)19-15(12)20/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | PBWLSUYHHZSWKY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|