C14H12ClN5O — CID 106420163
2-(chloromethyl)-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazole-4-carbonitrile (PubChem CID 106420163) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazole-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 106420163 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(chloromethyl)-1-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzimidazole-4-carbonitrile |
| SMILES | Cc1nc(CCn2c(CCl)nc3c(C#N)cccc32)no1 |
| InChI | InChI=1S/C14H12ClN5O/c1-9-17-12(19-21-9)5-6-20-11-4-2-3-10(8-16)14(11)18-13(20)7-15/h2-4H,5-7H2,1H3 |
| InChIKey | XSGOXSJXELRZJS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|