C16H14ClN3S — CID 104719790
2-(chloromethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]benzimidazole-4-carbonitrile (PubChem CID 104719790) has the molecular formula C16H14ClN3S and a molecular weight of 315.83 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]benzimidazole-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104719790 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(chloromethyl)-1-[(4,5-dimethylthiophen-2-yl)methyl]benzimidazole-4-carbonitrile |
| SMILES | Cc1cc(Cn2c(CCl)nc3c(C#N)cccc32)sc1C |
| InChI | InChI=1S/C16H14ClN3S/c1-10-6-13(21-11(10)2)9-20-14-5-3-4-12(8-18)16(14)19-15(20)7-17/h3-6H,7,9H2,1-2H3 |
| InChIKey | QGJWQGNCQUBCGS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|