C17H22ClN3 — CID 102906962
2-(chloromethyl)-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole-4-carbonitrile (PubChem CID 102906962) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 102906962 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-(chloromethyl)-1-(3-methyl-2-propan-2-ylbutyl)benzimidazole-4-carbonitrile |
| SMILES | CC(C)C(Cn1c(CCl)nc2c(C#N)cccc21)C(C)C |
| InChI | InChI=1S/C17H22ClN3/c1-11(2)14(12(3)4)10-21-15-7-5-6-13(9-19)17(15)20-16(21)8-18/h5-7,11-12,14H,8,10H2,1-4H3 |
| InChIKey | CUEMRFKKCVDPBQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|