C12H8ClF4N3 — CID 106295026
2-(chloromethyl)-1-(2,2,3,3-tetrafluoropropyl)benzimidazole-4-carbonitrile (PubChem CID 106295026) has the molecular formula C12H8ClF4N3 and a molecular weight of 305.66 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,2,3,3-tetrafluoropropyl)benzimidazole-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-1-(2,2,3,3-tetrafluoropropyl)benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 106295026 |
| Molecular Formula | C12H8ClF4N3 |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-(chloromethyl)-1-(2,2,3,3-tetrafluoropropyl)benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(CCl)n2CC(F)(F)C(F)F |
| InChI | InChI=1S/C12H8ClF4N3/c13-4-9-19-10-7(5-18)2-1-3-8(10)20(9)6-12(16,17)11(14)15/h1-3,11H,4,6H2 |
| InChIKey | ZMLZAPFBUUCTML-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|