C14H13ClN6 — CID 104719926
2-(chloromethyl)-1-[3-(triazol-1-yl)propyl]benzimidazole-4-carbonitrile (PubChem CID 104719926) has the molecular formula C14H13ClN6 and a molecular weight of 300.75 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[3-(triazol-1-yl)propyl]benzimidazole-4-carbonitrile.
| Compound Name | 2-(chloromethyl)-1-[3-(triazol-1-yl)propyl]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 104719926 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(chloromethyl)-1-[3-(triazol-1-yl)propyl]benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2c1nc(CCl)n2CCCn1ccnn1 |
| InChI | InChI=1S/C14H13ClN6/c15-9-13-18-14-11(10-16)3-1-4-12(14)21(13)7-2-6-20-8-5-17-19-20/h1,3-5,8H,2,6-7,9H2 |
| InChIKey | RCOFZBCQBNYGEW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|