C11H12ClN3 — CID 69065688
2-(chloromethyl)-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine (PubChem CID 69065688) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(chloromethyl)-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 69065688 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(chloromethyl)-3-(cyclopropylmethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCc1nc2cccnc2n1CC1CC1 |
| InChI | InChI=1S/C11H12ClN3/c12-6-10-14-9-2-1-5-13-11(9)15(10)7-8-3-4-8/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | RGXDLEIOUOEOFP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|