C20H21ClN4O2 — CID 97166677
benzyl (3R)-3-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 97166677) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is benzyl (3R)-3-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97166677 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | benzyl (3R)-3-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H](Cn2c(CCl)nc3cccnc32)C1 |
| InChI | InChI=1S/C20H21ClN4O2/c21-11-18-23-17-7-4-9-22-19(17)25(18)13-16-8-10-24(12-16)20(26)27-14-15-5-2-1-3-6-15/h1-7,9,16H,8,10-14H2/t16-/m0/s1 |
| InChIKey | FGJBIYASQDREPB-INIZCTEOSA-N |
| XLogP | 3.83 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|