C21H23ClN4O2 — CID 71646548
benzyl 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]piperidine-1-carboxylate (PubChem CID 71646548) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is benzyl 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71646548 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | benzyl 2-[[2-(chloromethyl)imidazo[4,5-b]pyridin-3-yl]methyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC1Cn1c(CCl)nc2cccnc21 |
| InChI | InChI=1S/C21H23ClN4O2/c22-13-19-24-18-10-6-11-23-20(18)26(19)14-17-9-4-5-12-25(17)21(27)28-15-16-7-2-1-3-8-16/h1-3,6-8,10-11,17H,4-5,9,12-15H2 |
| InChIKey | AZKCEBOIAYAGGX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|