C21H22ClN3O2 — CID 97166653
benzyl (2R)-2-[[2-(chloromethyl)benzimidazol-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 97166653) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is benzyl (2R)-2-[[2-(chloromethyl)benzimidazol-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[[2-(chloromethyl)benzimidazol-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97166653 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | benzyl (2R)-2-[[2-(chloromethyl)benzimidazol-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@H]1Cn1c(CCl)nc2ccccc21 |
| InChI | InChI=1S/C21H22ClN3O2/c22-13-20-23-18-10-4-5-11-19(18)25(20)14-17-9-6-12-24(17)21(26)27-15-16-7-2-1-3-8-16/h1-5,7-8,10-11,17H,6,9,12-15H2/t17-/m1/s1 |
| InChIKey | NWWRXZFJIKVLRQ-QGZVFWFLSA-N |
| XLogP | 4.58 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|