C21H22N4O3 — CID 97170825
benzyl (3R)-3-(2-acetylimidazo[4,5-b]pyridin-3-yl)piperidine-1-carboxylate (PubChem CID 97170825) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is benzyl (3R)-3-(2-acetylimidazo[4,5-b]pyridin-3-yl)piperidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-(2-acetylimidazo[4,5-b]pyridin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97170825 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | benzyl (3R)-3-(2-acetylimidazo[4,5-b]pyridin-3-yl)piperidine-1-carboxylate |
| SMILES | CC(=O)c1nc2cccnc2n1[C@@H]1CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H22N4O3/c1-15(26)19-23-18-10-5-11-22-20(18)25(19)17-9-6-12-24(13-17)21(27)28-14-16-7-3-2-4-8-16/h2-5,7-8,10-11,17H,6,9,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | QUFJBIGQTVQIEP-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |